C10H14O3 — CID 135075805
6-methyl-6-(2-methylpropyl)pyran-2,5-dione (PubChem CID 135075805) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-methyl-6-(2-methylpropyl)pyran-2,5-dione.
| Compound Name | 6-methyl-6-(2-methylpropyl)pyran-2,5-dione |
|---|---|
| PubChem CID | 135075805 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 6-methyl-6-(2-methylpropyl)pyran-2,5-dione |
| SMILES | CC(C)CC1(C)OC(=O)C=CC1=O |
| InChI | InChI=1S/C10H14O3/c1-7(2)6-10(3)8(11)4-5-9(12)13-10/h4-5,7H,6H2,1-3H3 |
| InChIKey | HSFBCFOKXDHSMJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |