C11H26N2O — CID 12721796
3-[3-(diethylamino)propyl-methylamino]propan-1-ol (PubChem CID 12721796) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl-methylamino]propan-1-ol.
| Compound Name | 3-[3-(diethylamino)propyl-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 12721796 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | 3-[3-(diethylamino)propyl-methylamino]propan-1-ol |
| SMILES | CCN(CC)CCCN(C)CCCO |
| InChI | InChI=1S/C11H26N2O/c1-4-13(5-2)10-6-8-12(3)9-7-11-14/h14H,4-11H2,1-3H3 |
| InChIKey | AYIRIQOAKWCWJF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |