C46H42N2O8 — CID 127239798
(1S,2S,3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;(1R,2R,3S,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 127239798) has the molecular formula C46H42N2O8 and a molecular weight of 750.85 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;(1R,2R,3S,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;(1R,2R,3S,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 127239798 |
| Molecular Formula | C46H42N2O8 |
| Molecular Weight | 750.85 g/mol |
| Exact Mass | 750.29 |
| IUPAC Name | (1S,2S,3R,4R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid;(1R,2R,3S,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(N[C@@H]1[C@H](C(=O)O)[C@H]2C=C[C@@H]1C2)OCC1c2ccccc2-c2ccccc21.O=C(N[C@H]1[C@@H](C(=O)O)[C@@H]2C=C[C@H]1C2)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/2C23H21NO4/c2*25-22(26)20-13-9-10-14(11-13)21(20)24-23(27)28-12-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h2*1-10,13-14,19-21H,11-12H2,(H,24,27)(H,25,26)/t2*13-,14+,20+,21-/m10/s1 |
| InChIKey | SQMZEJOTNOJTLH-OEFNFOLPSA-N |
| XLogP | 7.60 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.85 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|