C13H15N3OS — CID 12724294
4-methyl-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one (PubChem CID 12724294) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-methyl-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one.
| Compound Name | 4-methyl-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one |
|---|---|
| PubChem CID | 12724294 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-methyl-8-thia-10,12,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-trien-13-one |
| SMILES | CC1CCc2sc3c(c2C1)CN1CC(=O)NC1=N3 |
| InChI | InChI=1S/C13H15N3OS/c1-7-2-3-10-8(4-7)9-5-16-6-11(17)14-13(16)15-12(9)18-10/h7H,2-6H2,1H3,(H,14,15,17) |
| InChIKey | LPFDNESPYMKQFL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |