C12H13N5O3 — CID 127244163
[(E)-[4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]urea (PubChem CID 127244163) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is [(E)-[4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]urea.
| Compound Name | [(E)-[4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 127244163 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [(E)-[4-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]phenyl]methylideneamino]urea |
| SMILES | Cc1nonc1COc1ccc(/C=N/NC(N)=O)cc1 |
| InChI | InChI=1S/C12H13N5O3/c1-8-11(17-20-16-8)7-19-10-4-2-9(3-5-10)6-14-15-12(13)18/h2-6H,7H2,1H3,(H3,13,15,18)/b14-6+ |
| InChIKey | UZNIXTKOBZJCAG-MKMNVTDBSA-N |
| XLogP | 0.96 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|