C14H15N3O6S — CID 127244382
ethyl 2-(2-methoxy-5-sulfamoylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 127244382) has the molecular formula C14H15N3O6S and a molecular weight of 353.36 g/mol. Its IUPAC name is ethyl 2-(2-methoxy-5-sulfamoylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(2-methoxy-5-sulfamoylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 127244382 |
| Molecular Formula | C14H15N3O6S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | ethyl 2-(2-methoxy-5-sulfamoylphenyl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2cc(S(N)(=O)=O)ccc2OC)[nH]c1=O |
| InChI | InChI=1S/C14H15N3O6S/c1-3-23-14(19)10-7-16-12(17-13(10)18)9-6-8(24(15,20)21)4-5-11(9)22-2/h4-7H,3H2,1-2H3,(H2,15,20,21)(H,16,17,18) |
| InChIKey | OMXSQPQHSYBNIG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |