C11H12N4O3 — CID 82903966
ethyl 2-(3-methylimidazol-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 82903966) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is ethyl 2-(3-methylimidazol-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3-methylimidazol-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 82903966 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | ethyl 2-(3-methylimidazol-4-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2cncn2C)[nH]c1=O |
| InChI | InChI=1S/C11H12N4O3/c1-3-18-11(17)7-4-13-9(14-10(7)16)8-5-12-6-15(8)2/h4-6H,3H2,1-2H3,(H,13,14,16) |
| InChIKey | YNWBAVWIWPFJHD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |