C11H12ClN3O4 — CID 168687479
ethyl 2-(4-chloro-2-oxopyrrolidin-1-yl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 168687479) has the molecular formula C11H12ClN3O4 and a molecular weight of 285.69 g/mol. Its IUPAC name is ethyl 2-(4-chloro-2-oxopyrrolidin-1-yl)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(4-chloro-2-oxopyrrolidin-1-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 168687479 |
| Molecular Formula | C11H12ClN3O4 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | ethyl 2-(4-chloro-2-oxopyrrolidin-1-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CC(Cl)CC2=O)[nH]c1=O |
| InChI | InChI=1S/C11H12ClN3O4/c1-2-19-10(18)7-4-13-11(14-9(7)17)15-5-6(12)3-8(15)16/h4,6H,2-3,5H2,1H3,(H,13,14,17) |
| InChIKey | QFDIYPDKYLTLDU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|