C16H18F2N4 — CID 127244815
4-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]pyrimidin-2-amine (PubChem CID 127244815) has the molecular formula C16H18F2N4 and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]pyrimidin-2-amine.
| Compound Name | 4-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 127244815 |
| Molecular Formula | C16H18F2N4 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-[1-[(3,4-difluorophenyl)methyl]piperidin-2-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(C2CCCCN2Cc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C16H18F2N4/c17-12-5-4-11(9-13(12)18)10-22-8-2-1-3-15(22)14-6-7-20-16(19)21-14/h4-7,9,15H,1-3,8,10H2,(H2,19,20,21) |
| InChIKey | LGRQDDCHIXNJNK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |