C17H21F2N3 — CID 46952899
1-[(3,4-difluorophenyl)methyl]-2-(1-methylpyrazol-3-yl)azepane (PubChem CID 46952899) has the molecular formula C17H21F2N3 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-2-(1-methylpyrazol-3-yl)azepane.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-2-(1-methylpyrazol-3-yl)azepane |
|---|---|
| PubChem CID | 46952899 |
| Molecular Formula | C17H21F2N3 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-2-(1-methylpyrazol-3-yl)azepane |
| SMILES | Cn1ccc(C2CCCCCN2Cc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C17H21F2N3/c1-21-10-8-16(20-21)17-5-3-2-4-9-22(17)12-13-6-7-14(18)15(19)11-13/h6-8,10-11,17H,2-5,9,12H2,1H3 |
| InChIKey | AUJMVCBYNSJNGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |