C19H25N3O3 — CID 127245431
1-acetyl-4-(2H-chromen-3-ylmethyl)-N-methyl-1,4-diazepane-6-carboxamide (PubChem CID 127245431) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-acetyl-4-(2H-chromen-3-ylmethyl)-N-methyl-1,4-diazepane-6-carboxamide.
| Compound Name | 1-acetyl-4-(2H-chromen-3-ylmethyl)-N-methyl-1,4-diazepane-6-carboxamide |
|---|---|
| PubChem CID | 127245431 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-acetyl-4-(2H-chromen-3-ylmethyl)-N-methyl-1,4-diazepane-6-carboxamide |
| SMILES | CNC(=O)C1CN(CC2=Cc3ccccc3OC2)CCN(C(C)=O)C1 |
| InChI | InChI=1S/C19H25N3O3/c1-14(23)22-8-7-21(11-17(12-22)19(24)20-2)10-15-9-16-5-3-4-6-18(16)25-13-15/h3-6,9,17H,7-8,10-13H2,1-2H3,(H,20,24) |
| InChIKey | YGSCNMIABJQRGR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |