About [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone
[(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone (PubChem CID 97026862) has the molecular formula C21H28N2O2
and a molecular weight of 340.47 g/mol. Its IUPAC name is [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone.
Molecular Properties
| Compound Name | [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone |
| PubChem CID | 97026862 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone |
| SMILES | CC[C@H]1CN(C(=O)C2CC2)CC[C@@H]1NCC1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C21H28N2O2/c1-2-16-13-23(21(24)17-7-8-17)10-9-19(16)22-12-15-11-18-5-3-4-6-20(18)25-14-15/h3-6,11,16-17,19,22H,2,7-10,12-14H2,1H3/t16-,19-/m0/s1 |
| InChIKey | OVCBABHDOUAVPV-LPHOPBHVSA-N |
| XLogP | 3.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone?
The IUPAC name of [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone (CID 97026862) is [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone.
What is the SMILES notation for [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone?
The canonical SMILES for [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone is CC[C@H]1CN(C(=O)C2CC2)CC[C@@H]1NCC1=Cc2ccccc2OC1.
What is the InChIKey of [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone?
The InChIKey is OVCBABHDOUAVPV-LPHOPBHVSA-N. The full InChI is InChI=1S/C21H28N2O2/c1-2-16-13-23(21(24)17-7-8-17)10-9-19(16)22-12-15-11-18-5-3-4-6-20(18)25-14-15/h3-6,11,16-17,19,22H,2,7-10,12-14H2,1H3/t16-,19-/m0/s1.
What are the key properties of [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone?
[(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone has a molecular weight of 340.47 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-(2H-chromen-3-ylmethylamino)-3-ethylpiperidin-1-yl]-cyclopropylmethanone is sourced from PubChem (CID 97026862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).