About cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone
cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone (PubChem CID 97097541) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone |
| PubChem CID | 97097541 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone |
| SMILES | CC[C@@H]1CN(C(=O)C2CC2)CC[C@H]1NCc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C20H27N3O/c1-2-14-13-23(20(24)15-6-7-15)11-9-18(14)22-12-16-4-3-5-19-17(16)8-10-21-19/h3-5,8,10,14-15,18,21-22H,2,6-7,9,11-13H2,1H3/t14-,18-/m1/s1 |
| InChIKey | XBRNCLADJKAKRG-RDTXWAMCSA-N |
| XLogP | 3.29 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone?
The IUPAC name of cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone (CID 97097541) is cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone.
What is the SMILES notation for cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone?
The canonical SMILES for cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone is CC[C@@H]1CN(C(=O)C2CC2)CC[C@H]1NCc1cccc2[nH]ccc12.
What is the InChIKey of cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone?
The InChIKey is XBRNCLADJKAKRG-RDTXWAMCSA-N. The full InChI is InChI=1S/C20H27N3O/c1-2-14-13-23(20(24)15-6-7-15)11-9-18(14)22-12-16-4-3-5-19-17(16)8-10-21-19/h3-5,8,10,14-15,18,21-22H,2,6-7,9,11-13H2,1H3/t14-,18-/m1/s1.
What are the key properties of cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone?
cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone has a molecular weight of 325.46 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[(3R,4R)-3-ethyl-4-(1H-indol-4-ylmethylamino)piperidin-1-yl]methanone is sourced from PubChem (CID 97097541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).