C16H21N5O3 — CID 127246109
5,5-dimethyl-3-[2-oxo-2-(3-pyrazin-2-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 127246109) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-oxo-2-(3-pyrazin-2-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-oxo-2-(3-pyrazin-2-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 127246109 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 5,5-dimethyl-3-[2-oxo-2-(3-pyrazin-2-ylpiperidin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CC(=O)N2CCCC(c3cnccn3)C2)C1=O |
| InChI | InChI=1S/C16H21N5O3/c1-16(2)14(23)21(15(24)19-16)10-13(22)20-7-3-4-11(9-20)12-8-17-5-6-18-12/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H,19,24) |
| InChIKey | NCDDTTPWXOHUIE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|