C24H28N6O3 — CID 127248713
[3-[2-(dimethylamino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone (PubChem CID 127248713) has the molecular formula C24H28N6O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is [3-[2-(dimethylamino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone.
| Compound Name | [3-[2-(dimethylamino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 127248713 |
| Molecular Formula | C24H28N6O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | [3-[2-(dimethylamino)-5-pyrimidin-5-ylpyrimidin-4-yl]pyrrolidin-1-yl]-[4-(2-methoxyethoxy)phenyl]methanone |
| SMILES | COCCOc1ccc(C(=O)N2CCC(c3nc(N(C)C)ncc3-c3cncnc3)C2)cc1 |
| InChI | InChI=1S/C24H28N6O3/c1-29(2)24-27-14-21(19-12-25-16-26-13-19)22(28-24)18-8-9-30(15-18)23(31)17-4-6-20(7-5-17)33-11-10-32-3/h4-7,12-14,16,18H,8-11,15H2,1-3H3 |
| InChIKey | OYCZDSWFODBVOB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|