C12H13NO3 — CID 127256880
[(E,2R)-1-amino-1-oxo-4-phenylbut-3-en-2-yl] acetate (PubChem CID 127256880) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is [(E,2R)-1-amino-1-oxo-4-phenylbut-3-en-2-yl] acetate.
| Compound Name | [(E,2R)-1-amino-1-oxo-4-phenylbut-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 127256880 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | [(E,2R)-1-amino-1-oxo-4-phenylbut-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H](/C=C/c1ccccc1)C(N)=O |
| InChI | InChI=1S/C12H13NO3/c1-9(14)16-11(12(13)15)8-7-10-5-3-2-4-6-10/h2-8,11H,1H3,(H2,13,15)/b8-7+/t11-/m1/s1 |
| InChIKey | ILNUPQKUNXVNNV-WSKFYRRCSA-N |
| XLogP | 1.12 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |