C14H16O5 — CID 127258389
(2Z)-2-[1-(2-methoxy-4-methylphenyl)ethylidene]butanedioic acid (PubChem CID 127258389) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2Z)-2-[1-(2-methoxy-4-methylphenyl)ethylidene]butanedioic acid.
| Compound Name | (2Z)-2-[1-(2-methoxy-4-methylphenyl)ethylidene]butanedioic acid |
|---|---|
| PubChem CID | 127258389 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2Z)-2-[1-(2-methoxy-4-methylphenyl)ethylidene]butanedioic acid |
| SMILES | COc1cc(C)ccc1/C(C)=C(/CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H16O5/c1-8-4-5-10(12(6-8)19-3)9(2)11(14(17)18)7-13(15)16/h4-6H,7H2,1-3H3,(H,15,16)(H,17,18)/b11-9- |
| InChIKey | COUBPNATYVMCMG-LUAWRHEFSA-N |
| XLogP | 2.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|