C15H20O3 — CID 95458929
(E)-6-(2-methoxy-5-methylphenyl)hept-5-enoic acid (PubChem CID 95458929) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (E)-6-(2-methoxy-5-methylphenyl)hept-5-enoic acid.
| Compound Name | (E)-6-(2-methoxy-5-methylphenyl)hept-5-enoic acid |
|---|---|
| PubChem CID | 95458929 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (E)-6-(2-methoxy-5-methylphenyl)hept-5-enoic acid |
| SMILES | COc1ccc(C)cc1/C(C)=C/CCCC(=O)O |
| InChI | InChI=1S/C15H20O3/c1-11-8-9-14(18-3)13(10-11)12(2)6-4-5-7-15(16)17/h6,8-10H,4-5,7H2,1-3H3,(H,16,17)/b12-6+ |
| InChIKey | YVEXNBFYMOOMQB-WUXMJOGZSA-N |
| XLogP | 3.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|