C19H21BrN4O3 — CID 127262598
1-(3-methoxyphenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea bromide (PubChem CID 127262598) has the molecular formula C19H21BrN4O3 and a molecular weight of 433.31 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea bromide.
| Compound Name | 1-(3-methoxyphenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea bromide |
|---|---|
| PubChem CID | 127262598 |
| Molecular Formula | C19H21BrN4O3 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea bromide |
| SMILES | COc1cccc(NC(=O)Nc2c[n+](C(C)Cc3ccccc3)no2)c1.[Br-] |
| InChI | InChI=1S/C19H20N4O3.BrH/c1-14(11-15-7-4-3-5-8-15)23-13-18(26-22-23)21-19(24)20-16-9-6-10-17(12-16)25-2;/h3-10,12-14H,11H2,1-2H3,(H-,20,21,22,24);1H |
| InChIKey | JDCBOZUKSGRKAQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|