C19H19F3N5O2+ — CID 175956921
1-[3-(1-amino-3-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 175956921) has the molecular formula C19H19F3N5O2+ and a molecular weight of 406.39 g/mol. Its IUPAC name is 1-[3-(1-amino-3-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(1-amino-3-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 175956921 |
| Molecular Formula | C19H19F3N5O2+ |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[3-(1-amino-3-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | NCC(Cc1ccccc1)[n+]1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)on1 |
| InChI | InChI=1S/C19H18F3N5O2/c20-19(21,22)14-7-4-8-15(10-14)24-18(28)25-17-12-27(26-29-17)16(11-23)9-13-5-2-1-3-6-13/h1-8,10,12,16H,9,11,23H2,(H-,24,25,26,28)/p+1 |
| InChIKey | OBPWUZRSYIFTNQ-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|