C16H12F3N4O2+ — CID 170546976
1-(3-phenyloxadiazol-3-ium-5-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 170546976) has the molecular formula C16H12F3N4O2+ and a molecular weight of 349.29 g/mol. Its IUPAC name is 1-(3-phenyloxadiazol-3-ium-5-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(3-phenyloxadiazol-3-ium-5-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 170546976 |
| Molecular Formula | C16H12F3N4O2+ |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(3-phenyloxadiazol-3-ium-5-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1c[n+](-c2ccccc2)no1 |
| InChI | InChI=1S/C16H11F3N4O2/c17-16(18,19)11-5-4-6-12(9-11)20-15(24)21-14-10-23(22-25-14)13-7-2-1-3-8-13/h1-10H,(H-,20,21,22,24)/p+1 |
| InChIKey | MFPWZBPKEJJYIY-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 71.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|