C16H14BF3N5O4+ — CID 170547047
[6-[[5-[[3-(trifluoromethyl)phenyl]carbamoylamino]oxadiazol-3-ium-3-yl]methyl]-3-pyridinyl]boronic acid (PubChem CID 170547047) has the molecular formula C16H14BF3N5O4+ and a molecular weight of 408.13 g/mol. Its IUPAC name is [6-[[5-[[3-(trifluoromethyl)phenyl]carbamoylamino]oxadiazol-3-ium-3-yl]methyl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[[5-[[3-(trifluoromethyl)phenyl]carbamoylamino]oxadiazol-3-ium-3-yl]methyl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 170547047 |
| Molecular Formula | C16H14BF3N5O4+ |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [6-[[5-[[3-(trifluoromethyl)phenyl]carbamoylamino]oxadiazol-3-ium-3-yl]methyl]-3-pyridinyl]boronic acid |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1c[n+](Cc2ccc(B(O)O)cn2)no1 |
| InChI | InChI=1S/C16H13BF3N5O4/c18-16(19,20)10-2-1-3-12(6-10)22-15(26)23-14-9-25(24-29-14)8-13-5-4-11(7-21-13)17(27)28/h1-7,9,27-28H,8H2,(H-,22,23,24,26)/p+1 |
| InChIKey | XTSMAMLUGQMICR-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|