C21H18F3N6O2+ — CID 170547105
1-[3-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 170547105) has the molecular formula C21H18F3N6O2+ and a molecular weight of 443.41 g/mol. Its IUPAC name is 1-[3-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 170547105 |
| Molecular Formula | C21H18F3N6O2+ |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-[3-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cn1cc(-c2ccc(C[n+]3cc(NC(=O)Nc4cccc(C(F)(F)F)c4)on3)cc2)cn1 |
| InChI | InChI=1S/C21H17F3N6O2/c1-29-12-16(10-25-29)15-7-5-14(6-8-15)11-30-13-19(32-28-30)27-20(31)26-18-4-2-3-17(9-18)21(22,23)24/h2-10,12-13H,11H2,1H3,(H-,26,27,28,31)/p+1 |
| InChIKey | QMSAUNZPINTMAL-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|