C17H20F3N5O — CID 19293574
4-[(1-methylpyrazol-4-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 19293574) has the molecular formula C17H20F3N5O and a molecular weight of 367.38 g/mol. Its IUPAC name is 4-[(1-methylpyrazol-4-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[(1-methylpyrazol-4-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 19293574 |
| Molecular Formula | C17H20F3N5O |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 4-[(1-methylpyrazol-4-yl)methyl]-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | Cn1cc(CN2CCN(C(=O)Nc3cccc(C(F)(F)F)c3)CC2)cn1 |
| InChI | InChI=1S/C17H20F3N5O/c1-23-11-13(10-21-23)12-24-5-7-25(8-6-24)16(26)22-15-4-2-3-14(9-15)17(18,19)20/h2-4,9-11H,5-8,12H2,1H3,(H,22,26) |
| InChIKey | SNIDYWHKFTXQHE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |