C16H14FN4O2+ — CID 66576509
1-[3-[(3-fluorophenyl)methyl]oxadiazol-3-ium-5-yl]-3-phenylurea (PubChem CID 66576509) has the molecular formula C16H14FN4O2+ and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-[3-[(3-fluorophenyl)methyl]oxadiazol-3-ium-5-yl]-3-phenylurea.
| Compound Name | 1-[3-[(3-fluorophenyl)methyl]oxadiazol-3-ium-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 66576509 |
| Molecular Formula | C16H14FN4O2+ |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[3-[(3-fluorophenyl)methyl]oxadiazol-3-ium-5-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1c[n+](Cc2cccc(F)c2)no1 |
| InChI | InChI=1S/C16H13FN4O2/c17-13-6-4-5-12(9-13)10-21-11-15(23-20-21)19-16(22)18-14-7-2-1-3-8-14/h1-9,11H,10H2,(H-,18,19,20,22)/p+1 |
| InChIKey | BKEIKZIVPKELQN-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 71.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|