C23H25BF3N4O4+ — CID 170599775
1-[3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 170599775) has the molecular formula C23H25BF3N4O4+ and a molecular weight of 489.28 g/mol. Its IUPAC name is 1-[3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 170599775 |
| Molecular Formula | C23H25BF3N4O4+ |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 1-[3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC1(C)OB(c2ccc(C[n+]3cc(NC(=O)Nc4cccc(C(F)(F)F)c4)on3)cc2)OC1(C)C |
| InChI | InChI=1S/C23H24BF3N4O4/c1-21(2)22(3,4)35-24(34-21)17-10-8-15(9-11-17)13-31-14-19(33-30-31)29-20(32)28-18-7-5-6-16(12-18)23(25,26)27/h5-12,14H,13H2,1-4H3,(H-,28,29,30,32)/p+1 |
| InChIKey | LKPAXIDUEAXMKN-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|