C21H24BF3N2O3 — CID 68812082
1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]urea (PubChem CID 68812082) has the molecular formula C21H24BF3N2O3 and a molecular weight of 420.24 g/mol. Its IUPAC name is 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 68812082 |
| Molecular Formula | C21H24BF3N2O3 |
| Molecular Weight | 420.24 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CN(C(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24BF3N2O3/c1-19(2)20(3,4)30-22(29-19)15-9-11-16(12-10-15)26-18(28)27(5)17-8-6-7-14(13-17)21(23,24)25/h6-13H,1-5H3,(H,26,28) |
| InChIKey | OGABXUHLQDGQCD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|