C26H36BF3N2O3 — CID 155732749
ethane;N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(trifluoromethyl)anilino]phenyl]prop-2-enamide (PubChem CID 155732749) has the molecular formula C26H36BF3N2O3 and a molecular weight of 492.39 g/mol. Its IUPAC name is ethane;N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(trifluoromethyl)anilino]phenyl]prop-2-enamide.
| Compound Name | ethane;N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(trifluoromethyl)anilino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155732749 |
| Molecular Formula | C26H36BF3N2O3 |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | ethane;N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[3-(trifluoromethyl)anilino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(B2OC(C)(C)C(C)(C)O2)c(Nc2cccc(C(F)(F)F)c2)c1.CC.CC |
| InChI | InChI=1S/C22H24BF3N2O3.2C2H6/c1-6-19(29)28-16-10-11-17(23-30-20(2,3)21(4,5)31-23)18(13-16)27-15-9-7-8-14(12-15)22(24,25)26;2*1-2/h6-13,27H,1H2,2-5H3,(H,28,29);2*1-2H3 |
| InChIKey | ZXTYLONWZJNXES-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|