C18H18FN4O2+ — CID 123633694
1-(2-fluorophenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea (PubChem CID 123633694) has the molecular formula C18H18FN4O2+ and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea |
|---|---|
| PubChem CID | 123633694 |
| Molecular Formula | C18H18FN4O2+ |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]urea |
| SMILES | CC(Cc1ccccc1)[n+]1cc(NC(=O)Nc2ccccc2F)on1 |
| InChI | InChI=1S/C18H17FN4O2/c1-13(11-14-7-3-2-4-8-14)23-12-17(25-22-23)21-18(24)20-16-10-6-5-9-15(16)19/h2-10,12-13H,11H2,1H3,(H-,20,21,22,24)/p+1 |
| InChIKey | UUZQHNUIZAUZQU-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 71.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|