C19H14F3N8O2+ — CID 170599961
1-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 170599961) has the molecular formula C19H14F3N8O2+ and a molecular weight of 443.37 g/mol. Its IUPAC name is 1-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 170599961 |
| Molecular Formula | C19H14F3N8O2+ |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 1-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | O=C(Nc1cncc(C(F)(F)F)c1)Nc1c[n+](Cc2ccc(-c3cncnc3)cn2)no1 |
| InChI | InChI=1S/C19H13F3N8O2/c20-19(21,22)14-3-16(8-23-7-14)27-18(31)28-17-10-30(29-32-17)9-15-2-1-12(6-26-15)13-4-24-11-25-5-13/h1-8,10-11H,9H2,(H-,27,28,29,31)/p+1 |
| InChIKey | VEGNEMYJZVOJOM-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|