C21H17F3N7O2+ — CID 170547082
1-[3-[(1R)-1-(4-pyrimidin-5-ylphenyl)ethyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea (PubChem CID 170547082) has the molecular formula C21H17F3N7O2+ and a molecular weight of 456.41 g/mol. Its IUPAC name is 1-[3-[(1R)-1-(4-pyrimidin-5-ylphenyl)ethyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea.
| Compound Name | 1-[3-[(1R)-1-(4-pyrimidin-5-ylphenyl)ethyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 170547082 |
| Molecular Formula | C21H17F3N7O2+ |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-[3-[(1R)-1-(4-pyrimidin-5-ylphenyl)ethyl]oxadiazol-3-ium-5-yl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea |
| SMILES | C[C@H](c1ccc(-c2cncnc2)cc1)[n+]1cc(NC(=O)Nc2cncc(C(F)(F)F)c2)on1 |
| InChI | InChI=1S/C21H16F3N7O2/c1-13(14-2-4-15(5-3-14)16-7-26-12-27-8-16)31-11-19(33-30-31)29-20(32)28-18-6-17(9-25-10-18)21(22,23)24/h2-13H,1H3,(H-,28,29,30,32)/p+1/t13-/m1/s1 |
| InChIKey | PLURIPVQHLGNJM-CYBMUJFWSA-O |
| XLogP | 4.09 |
| TPSA | 109.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|