C21H16F3N7O3 — CID 175956914
N'-[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate (PubChem CID 175956914) has the molecular formula C21H16F3N7O3 and a molecular weight of 471.40 g/mol. Its IUPAC name is N'-[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate.
| Compound Name | N'-[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate |
|---|---|
| PubChem CID | 175956914 |
| Molecular Formula | C21H16F3N7O3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N'-[3-[[4-(2-methoxypyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate |
| SMILES | COc1ncc(-c2ccc(C[n+]3cc(N=C([O-])Nc4cncc(C(F)(F)F)c4)on3)cc2)cn1 |
| InChI | InChI=1S/C21H16F3N7O3/c1-33-20-26-7-15(8-27-20)14-4-2-13(3-5-14)11-31-12-18(34-30-31)29-19(32)28-17-6-16(9-25-10-17)21(22,23)24/h2-10,12H,11H2,1H3,(H-,28,29,30,32) |
| InChIKey | PLIGVIKJELQYJO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|