C24H21F3N6O3 — CID 176881979
N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 176881979) has the molecular formula C24H21F3N6O3 and a molecular weight of 498.47 g/mol. Its IUPAC name is N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 176881979 |
| Molecular Formula | C24H21F3N6O3 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[4-methoxy-3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | COc1ccc(N/C([O-])=N/c2c[n+](Cc3ccc(-c4c(C)ncnc4C)cc3)no2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H21F3N6O3/c1-14-22(15(2)29-13-28-14)17-6-4-16(5-7-17)11-33-12-21(36-32-33)31-23(34)30-18-8-9-20(35-3)19(10-18)24(25,26)27/h4-10,12-13H,11H2,1-3H3,(H-,30,31,32,34) |
| InChIKey | MTNBGUREOOCDTP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|