C21H17F3N8O2 — CID 175956949
N'-[3-[[6-(4,6-dimethylpyrimidin-5-yl)pyridazin-3-yl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 175956949) has the molecular formula C21H17F3N8O2 and a molecular weight of 470.42 g/mol. Its IUPAC name is N'-[3-[[6-(4,6-dimethylpyrimidin-5-yl)pyridazin-3-yl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[[6-(4,6-dimethylpyrimidin-5-yl)pyridazin-3-yl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 175956949 |
| Molecular Formula | C21H17F3N8O2 |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N'-[3-[[6-(4,6-dimethylpyrimidin-5-yl)pyridazin-3-yl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | Cc1ncnc(C)c1-c1ccc(C[n+]2cc(N=C([O-])Nc3cccc(C(F)(F)F)c3)on2)nn1 |
| InChI | InChI=1S/C21H17F3N8O2/c1-12-19(13(2)26-11-25-12)17-7-6-16(29-30-17)9-32-10-18(34-31-32)28-20(33)27-15-5-3-4-14(8-15)21(22,23)24/h3-8,10-11H,9H2,1-2H3,(H-,27,28,31,33) |
| InChIKey | VDTHOGQZMKTAOD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|