C23H20F3N5O3 — CID 175968095
N'-[3-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methylphenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 175968095) has the molecular formula C23H20F3N5O3 and a molecular weight of 471.44 g/mol. Its IUPAC name is N'-[3-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methylphenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methylphenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 175968095 |
| Molecular Formula | C23H20F3N5O3 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N'-[3-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methylphenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | Cc1cc(C[n+]2cc(N=C([O-])Nc3cccc(C(F)(F)F)c3)on2)ccc1-c1c(C)noc1C |
| InChI | InChI=1S/C23H20F3N5O3/c1-13-9-16(7-8-19(13)21-14(2)29-33-15(21)3)11-31-12-20(34-30-31)28-22(32)27-18-6-4-5-17(10-18)23(24,25)26/h4-10,12H,11H2,1-3H3,(H-,27,28,30,32) |
| InChIKey | QTWCTEQBQAJQCU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|