C22H18F3N7O2 — CID 175956888
N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate (PubChem CID 175956888) has the molecular formula C22H18F3N7O2 and a molecular weight of 469.43 g/mol. Its IUPAC name is N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate.
| Compound Name | N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate |
|---|---|
| PubChem CID | 175956888 |
| Molecular Formula | C22H18F3N7O2 |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N'-[3-[[4-(4,6-dimethylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate |
| SMILES | Cc1ncnc(C)c1-c1ccc(C[n+]2cc(N=C([O-])Nc3cncc(C(F)(F)F)c3)on2)cc1 |
| InChI | InChI=1S/C22H18F3N7O2/c1-13-20(14(2)28-12-27-13)16-5-3-15(4-6-16)10-32-11-19(34-31-32)30-21(33)29-18-7-17(8-26-9-18)22(23,24)25/h3-9,11-12H,10H2,1-2H3,(H-,29,30,31,33) |
| InChIKey | XVZUGBKDGQGKAR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|