C16H11F3IN5O2 — CID 170547001
N'-[3-[(4-iodophenyl)methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate (PubChem CID 170547001) has the molecular formula C16H11F3IN5O2 and a molecular weight of 489.20 g/mol. Its IUPAC name is N'-[3-[(4-iodophenyl)methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate.
| Compound Name | N'-[3-[(4-iodophenyl)methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate |
|---|---|
| PubChem CID | 170547001 |
| Molecular Formula | C16H11F3IN5O2 |
| Molecular Weight | 489.20 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | N'-[3-[(4-iodophenyl)methyl]oxadiazol-3-ium-5-yl]-N-[5-(trifluoromethyl)-3-pyridinyl]carbamimidate |
| SMILES | [O-]/C(=N\c1c[n+](Cc2ccc(I)cc2)no1)Nc1cncc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11F3IN5O2/c17-16(18,19)11-5-13(7-21-6-11)22-15(26)23-14-9-25(24-27-14)8-10-1-3-12(20)4-2-10/h1-7,9H,8H2,(H-,22,23,24,26) |
| InChIKey | PVGHUEBOYCAWDS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|