C23H18F3N5O3 — CID 175956967
N'-[3-[[4-(2-methoxy-4-pyridinyl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 175956967) has the molecular formula C23H18F3N5O3 and a molecular weight of 469.42 g/mol. Its IUPAC name is N'-[3-[[4-(2-methoxy-4-pyridinyl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[[4-(2-methoxy-4-pyridinyl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 175956967 |
| Molecular Formula | C23H18F3N5O3 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N'-[3-[[4-(2-methoxy-4-pyridinyl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | COc1cc(-c2ccc(C[n+]3cc(N=C([O-])Nc4cccc(C(F)(F)F)c4)on3)cc2)ccn1 |
| InChI | InChI=1S/C23H18F3N5O3/c1-33-20-11-17(9-10-27-20)16-7-5-15(6-8-16)13-31-14-21(34-30-31)29-22(32)28-19-4-2-3-18(12-19)23(24,25)26/h2-12,14H,13H2,1H3,(H-,28,29,30,32) |
| InChIKey | CHOKDUOOIYOPJI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|