C23H19F3N6O3 — CID 170547092
N'-[3-[[4-(4-methoxy-6-methylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 170547092) has the molecular formula C23H19F3N6O3 and a molecular weight of 484.44 g/mol. Its IUPAC name is N'-[3-[[4-(4-methoxy-6-methylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[[4-(4-methoxy-6-methylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 170547092 |
| Molecular Formula | C23H19F3N6O3 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N'-[3-[[4-(4-methoxy-6-methylpyrimidin-5-yl)phenyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | COc1ncnc(C)c1-c1ccc(C[n+]2cc(/N=C(\[O-])Nc3cccc(C(F)(F)F)c3)on2)cc1 |
| InChI | InChI=1S/C23H19F3N6O3/c1-14-20(21(34-2)28-13-27-14)16-8-6-15(7-9-16)11-32-12-19(35-31-32)30-22(33)29-18-5-3-4-17(10-18)23(24,25)26/h3-10,12-13H,11H2,1-2H3,(H-,29,30,31,33) |
| InChIKey | SPBGFFAJZABHSM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|