C20H14F3N7O2 — CID 170546934
N'-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 170546934) has the molecular formula C20H14F3N7O2 and a molecular weight of 441.37 g/mol. Its IUPAC name is N'-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 170546934 |
| Molecular Formula | C20H14F3N7O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N'-[3-[(5-pyrimidin-5-yl-2-pyridinyl)methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | [O-]/C(=N\c1c[n+](Cc2ccc(-c3cncnc3)cn2)no1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14F3N7O2/c21-20(22,23)15-2-1-3-16(6-15)27-19(31)28-18-11-30(29-32-18)10-17-5-4-13(9-26-17)14-7-24-12-25-8-14/h1-9,11-12H,10H2,(H-,27,28,29,31) |
| InChIKey | LRODOOVLUYDWTI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|