C24H19F3N6O2 — CID 175956969
N'-[3-[[5-(2,3-dihydro-1H-isoindol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 175956969) has the molecular formula C24H19F3N6O2 and a molecular weight of 480.45 g/mol. Its IUPAC name is N'-[3-[[5-(2,3-dihydro-1H-isoindol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[[5-(2,3-dihydro-1H-isoindol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 175956969 |
| Molecular Formula | C24H19F3N6O2 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N'-[3-[[5-(2,3-dihydro-1H-isoindol-4-yl)-2-pyridinyl]methyl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | [O-]C(=Nc1c[n+](Cc2ccc(-c3cccc4c3CNC4)cn2)no1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19F3N6O2/c25-24(26,27)17-4-2-5-18(9-17)30-23(34)31-22-14-33(32-35-22)13-19-8-7-16(11-29-19)20-6-1-3-15-10-28-12-21(15)20/h1-9,11,14,28H,10,12-13H2,(H-,30,31,32,34) |
| InChIKey | KDAPODWQGYLKLL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|