About 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride
2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride (PubChem CID 127264071) has the molecular formula C8H17Cl2N3
and a molecular weight of 226.15 g/mol. Its IUPAC name is 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride |
| PubChem CID | 127264071 |
| Molecular Formula | C8H17Cl2N3 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1=NCCC12CCNCC2 |
| InChI | InChI=1S/C8H15N3.2ClH/c9-7-8(3-6-11-7)1-4-10-5-2-8;;/h10H,1-6H2,(H2,9,11);2*1H |
| InChIKey | WXBKDCSUNSHRSQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride?
The IUPAC name of 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride (CID 127264071) is 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride.
What is the SMILES notation for 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride?
The canonical SMILES for 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride is Cl.Cl.NC1=NCCC12CCNCC2.
What is the InChIKey of 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride?
The InChIKey is WXBKDCSUNSHRSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3.2ClH/c9-7-8(3-6-11-7)1-4-10-5-2-8;;/h10H,1-6H2,(H2,9,11);2*1H.
What are the key properties of 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride?
2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride has a molecular weight of 226.15 g/mol, XLogP of 0.96, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diazaspiro[4.5]dec-1-en-1-amine;dihydrochloride is sourced from PubChem (CID 127264071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).