C15H15F3N4O — CID 127265777
2-methyl-N-[1H-1,2,4-triazol-5-yl-[3-(trifluoromethyl)phenyl]methyl]but-2-enamide (PubChem CID 127265777) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-methyl-N-[1H-1,2,4-triazol-5-yl-[3-(trifluoromethyl)phenyl]methyl]but-2-enamide.
| Compound Name | 2-methyl-N-[1H-1,2,4-triazol-5-yl-[3-(trifluoromethyl)phenyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 127265777 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-methyl-N-[1H-1,2,4-triazol-5-yl-[3-(trifluoromethyl)phenyl]methyl]but-2-enamide |
| SMILES | CC=C(C)C(=O)NC(c1cccc(C(F)(F)F)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C15H15F3N4O/c1-3-9(2)14(23)21-12(13-19-8-20-22-13)10-5-4-6-11(7-10)15(16,17)18/h3-8,12H,1-2H3,(H,21,23)(H,19,20,22) |
| InChIKey | QWVBFXGTZVLOMN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|