C13H12F3N3O — CID 127265839
1-(3-cyanophenyl)-3-[1-(trifluoromethyl)cyclobutyl]urea (PubChem CID 127265839) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[1-(trifluoromethyl)cyclobutyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[1-(trifluoromethyl)cyclobutyl]urea |
|---|---|
| PubChem CID | 127265839 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[1-(trifluoromethyl)cyclobutyl]urea |
| SMILES | N#Cc1cccc(NC(=O)NC2(C(F)(F)F)CCC2)c1 |
| InChI | InChI=1S/C13H12F3N3O/c14-13(15,16)12(5-2-6-12)19-11(20)18-10-4-1-3-9(7-10)8-17/h1,3-4,7H,2,5-6H2,(H2,18,19,20) |
| InChIKey | ILJITXCSONMSLI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |