C13H19FN4O2 — CID 127265874
tert-butyl N-[4-[(5-fluoropyrimidin-2-yl)amino]but-2-enyl]carbamate (PubChem CID 127265874) has the molecular formula C13H19FN4O2 and a molecular weight of 282.32 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-fluoropyrimidin-2-yl)amino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-fluoropyrimidin-2-yl)amino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 127265874 |
| Molecular Formula | C13H19FN4O2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | tert-butyl N-[4-[(5-fluoropyrimidin-2-yl)amino]but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=CCNc1ncc(F)cn1 |
| InChI | InChI=1S/C13H19FN4O2/c1-13(2,3)20-12(19)16-7-5-4-6-15-11-17-8-10(14)9-18-11/h4-5,8-9H,6-7H2,1-3H3,(H,16,19)(H,15,17,18) |
| InChIKey | OLDDNWMXWSWBFR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|