C9H13N3O2S — CID 127308401
N-methyl-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide (PubChem CID 127308401) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is N-methyl-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide.
| Compound Name | N-methyl-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 127308401 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-methyl-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide |
| SMILES | CNC(=O)N1CCOC(c2nccs2)C1 |
| InChI | InChI=1S/C9H13N3O2S/c1-10-9(13)12-3-4-14-7(6-12)8-11-2-5-15-8/h2,5,7H,3-4,6H2,1H3,(H,10,13) |
| InChIKey | DMUBWTCKNXBWCU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |