C14H23N3O2S — CID 167965443
N-(2,2-dimethylbutyl)-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide (PubChem CID 167965443) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide.
| Compound Name | N-(2,2-dimethylbutyl)-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 167965443 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(2,2-dimethylbutyl)-2-(1,3-thiazol-2-yl)morpholine-4-carboxamide |
| SMILES | CCC(C)(C)CNC(=O)N1CCOC(c2nccs2)C1 |
| InChI | InChI=1S/C14H23N3O2S/c1-4-14(2,3)10-16-13(18)17-6-7-19-11(9-17)12-15-5-8-20-12/h5,8,11H,4,6-7,9-10H2,1-3H3,(H,16,18) |
| InChIKey | NGWPVFYQWMLNST-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |