C15H28Si — CID 12730931
methyl-(4-methylpenta-1,2,3-trienyl)-bis(2-methylpropyl)silane (PubChem CID 12730931) has the molecular formula C15H28Si and a molecular weight of 236.47 g/mol. Its IUPAC name is methyl-(4-methylpenta-1,2,3-trienyl)-bis(2-methylpropyl)silane.
| Compound Name | methyl-(4-methylpenta-1,2,3-trienyl)-bis(2-methylpropyl)silane |
|---|---|
| PubChem CID | 12730931 |
| Molecular Formula | C15H28Si |
| Molecular Weight | 236.47 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | methyl-(4-methylpenta-1,2,3-trienyl)-bis(2-methylpropyl)silane |
| SMILES | CC(C)=C=C=C[Si](C)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C15H28Si/c1-13(2)9-8-10-16(7,11-14(3)4)12-15(5)6/h10,14-15H,11-12H2,1-7H3 |
| InChIKey | UEDLGTVQKHBIEZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|