C14H22Si — CID 12740718
triethyl(6-methylhepta-1,2,3,4,5-pentaenyl)silane (PubChem CID 12740718) has the molecular formula C14H22Si and a molecular weight of 218.42 g/mol. Its IUPAC name is triethyl(6-methylhepta-1,2,3,4,5-pentaenyl)silane.
| Compound Name | triethyl(6-methylhepta-1,2,3,4,5-pentaenyl)silane |
|---|---|
| PubChem CID | 12740718 |
| Molecular Formula | C14H22Si |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | triethyl(6-methylhepta-1,2,3,4,5-pentaenyl)silane |
| SMILES | CC[Si](C=C=C=C=C=C(C)C)(CC)CC |
| InChI | InChI=1S/C14H22Si/c1-6-15(7-2,8-3)13-11-9-10-12-14(4)5/h13H,6-8H2,1-5H3 |
| InChIKey | QKKRUQGWVZFFBP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|