C17H21F2N3O2 — CID 127317600
N-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]-3,5-difluorobenzamide (PubChem CID 127317600) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is N-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]-3,5-difluorobenzamide.
| Compound Name | N-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 127317600 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]-3,5-difluorobenzamide |
| SMILES | O=C(NCC(=O)N1CCN(C2CCC2)CC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H21F2N3O2/c18-13-8-12(9-14(19)10-13)17(24)20-11-16(23)22-6-4-21(5-7-22)15-2-1-3-15/h8-10,15H,1-7,11H2,(H,20,24) |
| InChIKey | IXUINSCRXHOKQD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |